ChemNet > CAS > 126-54-5 2,4,8,10-tetraoxaspiro[5.5]undecane
126-54-5 2,4,8,10-tetraoxaspiro[5.5]undecane
Produkt-Name |
2,4,8,10-tetraoxaspiro[5.5]undecane |
Englischer Name |
2,4,8,10-tetraoxaspiro[5.5]undecane; 2,4,8,10-Tetraoxaspiro(5.5)undecane; 5,5'-Spirobi-1,3-dioxane; 5,5'-Spirobi-m-dioxane; AI3-23521; Formaldehyde, cyclic diacetal with pentaerythritol; NSC 139455; Pentaerythritol bisformal; Pentaerythritol cyclic diformal; Pentaerythritol diformal; Pentaerythritol, bis(cyclic acetal) with formaldehyde; Pentaerythritol, dimethylene- |
Molekulare Formel |
C7H12O4 |
Molecular Weight |
160.1678 |
InChI |
InChI=1/C7H12O4/c1-7(2-9-5-8-1)3-10-6-11-4-7/h1-6H2 |
CAS Registry Number |
126-54-5 |
EINECS |
204-792-0 |
Molecular Structure |
|
Dichte |
1.2g/cm3 |
Siedepunkt |
253.4°C at 760 mmHg |
Brechungsindex |
1.474 |
Flammpunkt |
108.3°C |
Dampfdruck |
0.0292mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
|
|